About prop-1-enyl 2-cyanopropanoate
prop-1-enyl 2-cyanopropanoate (PubChem CID 139826828) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is prop-1-enyl 2-cyanopropanoate.
Molecular Properties
| Compound Name | prop-1-enyl 2-cyanopropanoate |
| PubChem CID | 139826828 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | prop-1-enyl 2-cyanopropanoate |
| SMILES | CC=COC(=O)C(C)C#N |
| InChI | InChI=1S/C7H9NO2/c1-3-4-10-7(9)6(2)5-8/h3-4,6H,1-2H3 |
| InChIKey | MJHQBLHSVXUVNM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze prop-1-enyl 2-cyanopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-enyl 2-cyanopropanoate?
The IUPAC name of prop-1-enyl 2-cyanopropanoate (CID 139826828) is prop-1-enyl 2-cyanopropanoate.
What is the SMILES notation for prop-1-enyl 2-cyanopropanoate?
The canonical SMILES for prop-1-enyl 2-cyanopropanoate is CC=COC(=O)C(C)C#N.
What is the InChIKey of prop-1-enyl 2-cyanopropanoate?
The InChIKey is MJHQBLHSVXUVNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-3-4-10-7(9)6(2)5-8/h3-4,6H,1-2H3.
What are the key properties of prop-1-enyl 2-cyanopropanoate?
prop-1-enyl 2-cyanopropanoate has a molecular weight of 139.15 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-enyl 2-cyanopropanoate is sourced from PubChem (CID 139826828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).