C24H37NO5 — CID 139826886
[2-(4-ethenylphenyl)-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] 1-ethoxyethyl carbonate (PubChem CID 139826886) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is [2-(4-ethenylphenyl)-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] 1-ethoxyethyl carbonate.
| Compound Name | [2-(4-ethenylphenyl)-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] 1-ethoxyethyl carbonate |
|---|---|
| PubChem CID | 139826886 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | [2-(4-ethenylphenyl)-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] 1-ethoxyethyl carbonate |
| SMILES | C=Cc1ccc(C(COC(=O)OC(C)OCC)ON2C(C)(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C24H37NO5/c1-8-19-11-13-20(14-12-19)21(17-28-22(26)29-18(3)27-9-2)30-25-23(4,5)15-10-16-24(25,6)7/h8,11-14,18,21H,1,9-10,15-17H2,2-7H3 |
| InChIKey | WZEOIKZPNPZFCU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|