C24H30O5 — CID 139828824
1-cyclohexyl-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4,5-dicarboxylic acid (PubChem CID 139828824) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-cyclohexyl-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4,5-dicarboxylic acid.
| Compound Name | 1-cyclohexyl-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 139828824 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-cyclohexyl-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4,5-dicarboxylic acid |
| SMILES | O=C(O)C1C2CC(C1C(=O)O)C1C2C2OC1(C1CCCCC1)C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C24H30O5/c25-22(26)16-13-9-14(17(16)23(27)28)20-18(13)21-15-10-6-7-11(8-10)19(15)24(20,29-21)12-4-2-1-3-5-12/h6-7,10-21H,1-5,8-9H2,(H,25,26)(H,27,28) |
| InChIKey | AJLUSRHWDHPQKZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|