C22H26O3 — CID 139828849
19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15-carboxylic acid (PubChem CID 139828849) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15-carboxylic acid.
| Compound Name | 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15-carboxylic acid |
|---|---|
| PubChem CID | 139828849 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 19-oxaoctacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-6-ene-15-carboxylic acid |
| SMILES | O=C(O)C1CC2CC1C1C3OC(C21)C1C2CC(C4C5C=CC(C5)C24)C31 |
| InChI | InChI=1S/C22H26O3/c23-22(24)11-5-9-4-10(11)17-16(9)20-18-12-6-13(19(18)21(17)25-20)15-8-2-1-7(3-8)14(12)15/h1-2,7-21H,3-6H2,(H,23,24) |
| InChIKey | GCLKQDQNOSZRAU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|