C15H18O5 — CID 139828857
2-[10-(carboxymethyl)-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl]acetic acid (PubChem CID 139828857) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-[10-(carboxymethyl)-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl]acetic acid.
| Compound Name | 2-[10-(carboxymethyl)-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl]acetic acid |
|---|---|
| PubChem CID | 139828857 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[10-(carboxymethyl)-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl]acetic acid |
| SMILES | O=C(O)CC1C(CC(=O)O)C2OC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C15H18O5/c16-10(17)4-8-9(5-11(18)19)15-13-7-2-1-6(3-7)12(13)14(8)20-15/h1-2,6-9,12-15H,3-5H2,(H,16,17)(H,18,19) |
| InChIKey | HPIQUZCYQPRMEP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|