C18H24O3 — CID 139828915
11,12-dimethoxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene (PubChem CID 139828915) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 11,12-dimethoxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene.
| Compound Name | 11,12-dimethoxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene |
|---|---|
| PubChem CID | 139828915 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 11,12-dimethoxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene |
| SMILES | COC1C2CC(C1OC)C1C3OC(C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C18H24O3/c1-19-15-9-6-10(16(15)20-2)14-13(9)17-11-7-3-4-8(5-7)12(11)18(14)21-17/h3-4,7-18H,5-6H2,1-2H3 |
| InChIKey | TYHSMQXIPSZYMS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|