C23H28O6S — CID 139828953
tert-butyl 10-(4-methylphenyl)sulfonyloxy-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate (PubChem CID 139828953) has the molecular formula C23H28O6S and a molecular weight of 432.54 g/mol. Its IUPAC name is tert-butyl 10-(4-methylphenyl)sulfonyloxy-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate.
| Compound Name | tert-butyl 10-(4-methylphenyl)sulfonyloxy-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate |
|---|---|
| PubChem CID | 139828953 |
| Molecular Formula | C23H28O6S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | tert-butyl 10-(4-methylphenyl)sulfonyloxy-11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C3OC(C2C(=O)OC(C)(C)C)C2C4C=CC(C4)C32)cc1 |
| InChI | InChI=1S/C23H28O6S/c1-12-5-9-15(10-6-12)30(25,26)29-21-18(22(24)28-23(2,3)4)19-16-13-7-8-14(11-13)17(16)20(21)27-19/h5-10,13-14,16-21H,11H2,1-4H3 |
| InChIKey | SUGLWDKQSBFMNW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|