C28H34O6S — CID 139828980
tert-butyl 5-(4-methylphenyl)sulfonyloxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate (PubChem CID 139828980) has the molecular formula C28H34O6S and a molecular weight of 498.64 g/mol. Its IUPAC name is tert-butyl 5-(4-methylphenyl)sulfonyloxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate.
| Compound Name | tert-butyl 5-(4-methylphenyl)sulfonyloxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate |
|---|---|
| PubChem CID | 139828980 |
| Molecular Formula | C28H34O6S |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | tert-butyl 5-(4-methylphenyl)sulfonyloxy-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C3CC(C2C(=O)OC(C)(C)C)C2C4OC(C5C6C=CC(C6)C45)C32)cc1 |
| InChI | InChI=1S/C28H34O6S/c1-13-5-9-16(10-6-13)35(30,31)34-24-18-12-17(23(24)27(29)33-28(2,3)4)21-22(18)26-20-15-8-7-14(11-15)19(20)25(21)32-26/h5-10,14-15,17-26H,11-12H2,1-4H3 |
| InChIKey | TUHCURMXNBNNAX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|