C22H38O8 — CID 139829169
8,9-bis(methoxycarbonyl)-3,3-dimethylhexadecanedioic acid (PubChem CID 139829169) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is 8,9-bis(methoxycarbonyl)-3,3-dimethylhexadecanedioic acid.
| Compound Name | 8,9-bis(methoxycarbonyl)-3,3-dimethylhexadecanedioic acid |
|---|---|
| PubChem CID | 139829169 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 8,9-bis(methoxycarbonyl)-3,3-dimethylhexadecanedioic acid |
| SMILES | COC(=O)C(CCCCCCC(=O)O)C(CCCCC(C)(C)CC(=O)O)C(=O)OC |
| InChI | InChI=1S/C22H38O8/c1-22(2,15-19(25)26)14-10-9-12-17(21(28)30-4)16(20(27)29-3)11-7-5-6-8-13-18(23)24/h16-17H,5-15H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | YCADJDZXRKFTAI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|