C12H5Cl2F4NO — CID 139829449
4-chloro-3-(4-chloro-2-fluorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 139829449) has the molecular formula C12H5Cl2F4NO and a molecular weight of 326.08 g/mol. Its IUPAC name is 4-chloro-3-(4-chloro-2-fluorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 4-chloro-3-(4-chloro-2-fluorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 139829449 |
| Molecular Formula | C12H5Cl2F4NO |
| Molecular Weight | 326.08 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 4-chloro-3-(4-chloro-2-fluorophenyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(C(F)(F)F)cc(Cl)c1-c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H5Cl2F4NO/c13-5-1-2-6(8(15)3-5)10-7(14)4-9(12(16,17)18)19-11(10)20/h1-4H,(H,19,20) |
| InChIKey | JPRRYUMRGNZKTG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.08 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |