C15H14F2N6O2 — CID 139829549
N'-[6-[4-(difluoromethoxy)phenyl]-5-oxo-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 139829549) has the molecular formula C15H14F2N6O2 and a molecular weight of 348.31 g/mol. Its IUPAC name is N'-[6-[4-(difluoromethoxy)phenyl]-5-oxo-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[6-[4-(difluoromethoxy)phenyl]-5-oxo-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 139829549 |
| Molecular Formula | C15H14F2N6O2 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N'-[6-[4-(difluoromethoxy)phenyl]-5-oxo-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc2[nH]c(=O)c(-c3ccc(OC(F)F)cc3)cn2n1 |
| InChI | InChI=1S/C15H14F2N6O2/c1-22(2)8-18-14-20-15-19-12(24)11(7-23(15)21-14)9-3-5-10(6-4-9)25-13(16)17/h3-8,13H,1-2H3,(H,19,20,21,24)/b18-8+ |
| InChIKey | XVAZZAOCGWMUAB-QGMBQPNBSA-N |
| XLogP | 1.91 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|