C16H15ClN6O2 — CID 139829550
6-(4-chlorophenyl)-2-(morpholin-4-ylmethylideneamino)-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 139829550) has the molecular formula C16H15ClN6O2 and a molecular weight of 358.79 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(morpholin-4-ylmethylideneamino)-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 6-(4-chlorophenyl)-2-(morpholin-4-ylmethylideneamino)-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 139829550 |
| Molecular Formula | C16H15ClN6O2 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(morpholin-4-ylmethylideneamino)-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | O=c1[nH]c2nc(N=CN3CCOCC3)nn2cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN6O2/c17-12-3-1-11(2-4-12)13-9-23-16(19-14(13)24)20-15(21-23)18-10-22-5-7-25-8-6-22/h1-4,9-10H,5-8H2,(H,19,20,21,24) |
| InChIKey | JOEKFLUYLDDWET-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|