C54H23BF28O2S — CID 139829635
[2-(2-phenoxyethoxy)phenyl]-diphenylsulfanium;tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide (PubChem CID 139829635) has the molecular formula C54H23BF28O2S and a molecular weight of 1278.60 g/mol. Its IUPAC name is [2-(2-phenoxyethoxy)phenyl]-diphenylsulfanium;tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide.
| Compound Name | [2-(2-phenoxyethoxy)phenyl]-diphenylsulfanium;tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139829635 |
| Molecular Formula | C54H23BF28O2S |
| Molecular Weight | 1278.60 g/mol |
| Exact Mass | 1278.11 |
| IUPAC Name | [2-(2-phenoxyethoxy)phenyl]-diphenylsulfanium;tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide |
| SMILES | Fc1c(F)c(F)c(C(F)(F)F)c([B-](c2c(F)c(F)c(F)c(F)c2C(F)(F)F)(c2c(F)c(F)c(F)c(F)c2C(F)(F)F)c2c(F)c(F)c(F)c(F)c2C(F)(F)F)c1F.c1ccc(OCCOc2ccccc2[S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28BF28.C26H23O2S/c30-9-1(25(46,47)48)5(13(34)21(42)17(9)38)29(6-2(26(49,50)51)10(31)18(39)22(43)14(6)35,7-3(27(52,53)54)11(32)19(40)23(44)15(7)36)8-4(28(55,56)57)12(33)20(41)24(45)16(8)37;1-4-12-22(13-5-1)27-20-21-28-25-18-10-11-19-26(25)29(23-14-6-2-7-15-23)24-16-8-3-9-17-24/h;1-19H,20-21H2/q-1;+1 |
| InChIKey | LHLBMKMTWZLALC-UHFFFAOYSA-N |
| XLogP | 15.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1278.60 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|