C55H33BF28O6S — CID 139829746
tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide;tris[2-(2-methoxyethoxy)phenyl]sulfanium (PubChem CID 139829746) has the molecular formula C55H33BF28O6S and a molecular weight of 1364.69 g/mol. Its IUPAC name is tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide;tris[2-(2-methoxyethoxy)phenyl]sulfanium.
| Compound Name | tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide;tris[2-(2-methoxyethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 139829746 |
| Molecular Formula | C55H33BF28O6S |
| Molecular Weight | 1364.69 g/mol |
| Exact Mass | 1364.16 |
| IUPAC Name | tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide;tris[2-(2-methoxyethoxy)phenyl]sulfanium |
| SMILES | COCCOc1ccccc1[S+](c1ccccc1OCCOC)c1ccccc1OCCOC.Fc1c(F)c(F)c(C(F)(F)F)c([B-](c2c(F)c(F)c(F)c(F)c2C(F)(F)F)(c2c(F)c(F)c(F)c(F)c2C(F)(F)F)c2c(F)c(F)c(F)c(F)c2C(F)(F)F)c1F |
| InChI | InChI=1S/C28BF28.C27H33O6S/c30-9-1(25(46,47)48)5(13(34)21(42)17(9)38)29(6-2(26(49,50)51)10(31)18(39)22(43)14(6)35,7-3(27(52,53)54)11(32)19(40)23(44)15(7)36)8-4(28(55,56)57)12(33)20(41)24(45)16(8)37;1-28-16-19-31-22-10-4-7-13-25(22)34(26-14-8-5-11-23(26)32-20-17-29-2)27-15-9-6-12-24(27)33-21-18-30-3/h;4-15H,16-21H2,1-3H3/q-1;+1 |
| InChIKey | NMBXCMCBEPRITK-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1364.69 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|