C44H18BF28IOS — CID 139829880
[2-(2-ethoxyethylsulfanyl)phenyl]-phenyliodanium;tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide (PubChem CID 139829880) has the molecular formula C44H18BF28IOS and a molecular weight of 1264.35 g/mol. Its IUPAC name is [2-(2-ethoxyethylsulfanyl)phenyl]-phenyliodanium;tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide.
| Compound Name | [2-(2-ethoxyethylsulfanyl)phenyl]-phenyliodanium;tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139829880 |
| Molecular Formula | C44H18BF28IOS |
| Molecular Weight | 1264.35 g/mol |
| Exact Mass | 1263.98 |
| IUPAC Name | [2-(2-ethoxyethylsulfanyl)phenyl]-phenyliodanium;tetrakis[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]boranuide |
| SMILES | CCOCCSc1ccccc1[I+]c1ccccc1.Fc1c(F)c(F)c(C(F)(F)F)c([B-](c2c(F)c(F)c(F)c(F)c2C(F)(F)F)(c2c(F)c(F)c(F)c(F)c2C(F)(F)F)c2c(F)c(F)c(F)c(F)c2C(F)(F)F)c1F |
| InChI | InChI=1S/C28BF28.C16H18IOS/c30-9-1(25(46,47)48)5(13(34)21(42)17(9)38)29(6-2(26(49,50)51)10(31)18(39)22(43)14(6)35,7-3(27(52,53)54)11(32)19(40)23(44)15(7)36)8-4(28(55,56)57)12(33)20(41)24(45)16(8)37;1-2-18-12-13-19-16-11-7-6-10-15(16)17-14-8-4-3-5-9-14/h;3-11H,2,12-13H2,1H3/q-1;+1 |
| InChIKey | AFFATWZNXYURRX-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1264.35 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|