About 5-iodopyridin-2-amine;dihydroiodide
5-iodopyridin-2-amine;dihydroiodide (PubChem CID 139830080) has the molecular formula C5H7I3N2
and a molecular weight of 475.84 g/mol. Its IUPAC name is 5-iodopyridin-2-amine;dihydroiodide.
Molecular Properties
| Compound Name | 5-iodopyridin-2-amine;dihydroiodide |
| PubChem CID | 139830080 |
| Molecular Formula | C5H7I3N2 |
| Molecular Weight | 475.84 g/mol |
| Exact Mass | 475.77 |
| IUPAC Name | 5-iodopyridin-2-amine;dihydroiodide |
| SMILES | I.I.Nc1ccc(I)cn1 |
| InChI | InChI=1S/C5H5IN2.2HI/c6-4-1-2-5(7)8-3-4;;/h1-3H,(H2,7,8);2*1H |
| InChIKey | OKROVDHWHWXKBY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.84 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodopyridin-2-amine;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodopyridin-2-amine;dihydroiodide?
The IUPAC name of 5-iodopyridin-2-amine;dihydroiodide (CID 139830080) is 5-iodopyridin-2-amine;dihydroiodide.
What is the SMILES notation for 5-iodopyridin-2-amine;dihydroiodide?
The canonical SMILES for 5-iodopyridin-2-amine;dihydroiodide is I.I.Nc1ccc(I)cn1.
What is the InChIKey of 5-iodopyridin-2-amine;dihydroiodide?
The InChIKey is OKROVDHWHWXKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5IN2.2HI/c6-4-1-2-5(7)8-3-4;;/h1-3H,(H2,7,8);2*1H.
What are the key properties of 5-iodopyridin-2-amine;dihydroiodide?
5-iodopyridin-2-amine;dihydroiodide has a molecular weight of 475.84 g/mol, XLogP of 2.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodopyridin-2-amine;dihydroiodide is sourced from PubChem (CID 139830080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).