About (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride
(2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride (PubChem CID 139830287) has the molecular formula C10H25Cl2N3O
and a molecular weight of 274.24 g/mol. Its IUPAC name is (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride.
Molecular Properties
| Compound Name | (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride |
| PubChem CID | 139830287 |
| Molecular Formula | C10H25Cl2N3O |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride |
| SMILES | CCN(CC)C(=O)[C@@H](N)CCCCN.Cl.Cl |
| InChI | InChI=1S/C10H23N3O.2ClH/c1-3-13(4-2)10(14)9(12)7-5-6-8-11;;/h9H,3-8,11-12H2,1-2H3;2*1H/t9-;;/m0../s1 |
| InChIKey | FGJYULDMYRHQNC-WWPIYYJJSA-N |
| XLogP | 1.15 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride?
The IUPAC name of (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride (CID 139830287) is (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride.
What is the SMILES notation for (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride?
The canonical SMILES for (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride is CCN(CC)C(=O)[C@@H](N)CCCCN.Cl.Cl.
What is the InChIKey of (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride?
The InChIKey is FGJYULDMYRHQNC-WWPIYYJJSA-N. The full InChI is InChI=1S/C10H23N3O.2ClH/c1-3-13(4-2)10(14)9(12)7-5-6-8-11;;/h9H,3-8,11-12H2,1-2H3;2*1H/t9-;;/m0../s1.
What are the key properties of (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride?
(2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride has a molecular weight of 274.24 g/mol, XLogP of 1.15, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diamino-N,N-diethylhexanamide;dihydrochloride is sourced from PubChem (CID 139830287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).