C19H18N4O4S2 — CID 139830518
(6R,7R)-7-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-3-(1H-pyrazol-4-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid (PubChem CID 139830518) has the molecular formula C19H18N4O4S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is (6R,7R)-7-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-3-(1H-pyrazol-4-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid.
| Compound Name | (6R,7R)-7-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-3-(1H-pyrazol-4-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 139830518 |
| Molecular Formula | C19H18N4O4S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (6R,7R)-7-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-3-(1H-pyrazol-4-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
| SMILES | O=C(S)C1=C(Cc2cn[nH]c2)CS[C@@H]2[C@H](NC(=O)[C@@H](O)c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C19H18N4O4S2/c24-15(11-4-2-1-3-5-11)16(25)22-13-17(26)23-14(19(27)28)12(9-29-18(13)23)6-10-7-20-21-8-10/h1-5,7-8,13,15,18,24H,6,9H2,(H,20,21)(H,22,25)(H,27,28)/t13-,15+,18-/m1/s1 |
| InChIKey | KYGAVMRACPWBKD-QIIPPGSGSA-N |
| XLogP | 0.80 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|