C23H30F2S — CID 139830639
(8S,10R,13S,14S)-3,17-bis(fluoromethylidene)-13-methyl-10-(2-methylsulfanylethyl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 139830639) has the molecular formula C23H30F2S and a molecular weight of 376.56 g/mol. Its IUPAC name is (8S,10R,13S,14S)-3,17-bis(fluoromethylidene)-13-methyl-10-(2-methylsulfanylethyl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,10R,13S,14S)-3,17-bis(fluoromethylidene)-13-methyl-10-(2-methylsulfanylethyl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 139830639 |
| Molecular Formula | C23H30F2S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (8S,10R,13S,14S)-3,17-bis(fluoromethylidene)-13-methyl-10-(2-methylsulfanylethyl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CSCC[C@]12CCC(=CF)C=C1CC[C@@H]1C2=CC[C@]2(C)C(=CF)CC[C@@H]12 |
| InChI | InChI=1S/C23H30F2S/c1-22-9-8-21-19(20(22)6-4-18(22)15-25)5-3-17-13-16(14-24)7-10-23(17,21)11-12-26-2/h8,13-15,19-20H,3-7,9-12H2,1-2H3/t19-,20-,22+,23+/m0/s1 |
| InChIKey | PLCBXROACUIZCV-JFJDKTSWSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|