About 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate
1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate (PubChem CID 139830674) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate.
Molecular Properties
| Compound Name | 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate |
| PubChem CID | 139830674 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate |
| SMILES | CC1(NCCN)C=CC=CC1N.O |
| InChI | InChI=1S/C9H17N3.H2O/c1-9(12-7-6-10)5-3-2-4-8(9)11;/h2-5,8,12H,6-7,10-11H2,1H3;1H2 |
| InChIKey | WCQAGORGLQQIKN-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate?
The IUPAC name of 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate (CID 139830674) is 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate.
What is the SMILES notation for 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate?
The canonical SMILES for 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate is CC1(NCCN)C=CC=CC1N.O.
What is the InChIKey of 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate?
The InChIKey is WCQAGORGLQQIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3.H2O/c1-9(12-7-6-10)5-3-2-4-8(9)11;/h2-5,8,12H,6-7,10-11H2,1H3;1H2.
What are the key properties of 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate?
1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate has a molecular weight of 185.27 g/mol, XLogP of -1.08, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(2-aminoethyl)-1-methylcyclohexa-3,5-diene-1,2-diamine;hydrate is sourced from PubChem (CID 139830674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).