C38H48N2O6 — CID 139830847
2-[[4-[10-[4-(2-cyano-4-methyl-3-oxopent-1-enyl)-2-methoxyphenoxy]decoxy]-3-methoxyphenyl]methylidene]-4-methyl-3-oxopentanenitrile (PubChem CID 139830847) has the molecular formula C38H48N2O6 and a molecular weight of 628.81 g/mol. Its IUPAC name is 2-[[4-[10-[4-(2-cyano-4-methyl-3-oxopent-1-enyl)-2-methoxyphenoxy]decoxy]-3-methoxyphenyl]methylidene]-4-methyl-3-oxopentanenitrile.
| Compound Name | 2-[[4-[10-[4-(2-cyano-4-methyl-3-oxopent-1-enyl)-2-methoxyphenoxy]decoxy]-3-methoxyphenyl]methylidene]-4-methyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 139830847 |
| Molecular Formula | C38H48N2O6 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | 2-[[4-[10-[4-(2-cyano-4-methyl-3-oxopent-1-enyl)-2-methoxyphenoxy]decoxy]-3-methoxyphenyl]methylidene]-4-methyl-3-oxopentanenitrile |
| SMILES | COc1cc(C=C(C#N)C(=O)C(C)C)ccc1OCCCCCCCCCCOc1ccc(C=C(C#N)C(=O)C(C)C)cc1OC |
| InChI | InChI=1S/C38H48N2O6/c1-27(2)37(41)31(25-39)21-29-15-17-33(35(23-29)43-5)45-19-13-11-9-7-8-10-12-14-20-46-34-18-16-30(24-36(34)44-6)22-32(26-40)38(42)28(3)4/h15-18,21-24,27-28H,7-14,19-20H2,1-6H3 |
| InChIKey | TYFPRBLFVQHEMZ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|