C24H29N5O5 — CID 139830945
[amino-[7-[[1-[(2-nitrophenyl)methyl]piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylidene]carbamic acid (PubChem CID 139830945) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is [amino-[7-[[1-[(2-nitrophenyl)methyl]piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylidene]carbamic acid.
| Compound Name | [amino-[7-[[1-[(2-nitrophenyl)methyl]piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 139830945 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [amino-[7-[[1-[(2-nitrophenyl)methyl]piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylidene]carbamic acid |
| SMILES | NC(=NC(=O)O)C1NCCc2ccc(OCC3CCN(Cc4ccccc4[N+](=O)[O-])CC3)cc21 |
| InChI | InChI=1S/C24H29N5O5/c25-23(27-24(30)31)22-20-13-19(6-5-17(20)7-10-26-22)34-15-16-8-11-28(12-9-16)14-18-3-1-2-4-21(18)29(32)33/h1-6,13,16,22,26H,7-12,14-15H2,(H2,25,27)(H,30,31) |
| InChIKey | UQWMZBKPYMUNCY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|