C26H31N5O3 — CID 139830986
[7-[[1-(1H-indol-2-ylmethyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinoline-1-carboximidoyl]carbamic acid (PubChem CID 139830986) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is [7-[[1-(1H-indol-2-ylmethyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinoline-1-carboximidoyl]carbamic acid.
| Compound Name | [7-[[1-(1H-indol-2-ylmethyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinoline-1-carboximidoyl]carbamic acid |
|---|---|
| PubChem CID | 139830986 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | [7-[[1-(1H-indol-2-ylmethyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinoline-1-carboximidoyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)O)C1NCCc2ccc(OCC3CCN(Cc4cc5ccccc5[nH]4)CC3)cc21 |
| InChI | InChI=1S/C26H31N5O3/c27-25(30-26(32)33)24-22-14-21(6-5-18(22)7-10-28-24)34-16-17-8-11-31(12-9-17)15-20-13-19-3-1-2-4-23(19)29-20/h1-6,13-14,17,24,28-29H,7-12,15-16H2,(H2,27,30)(H,32,33) |
| InChIKey | LZIGIRJHAQNUOP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|