About 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene
2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene (PubChem CID 139832437) has the molecular formula C14H15F3O2S
and a molecular weight of 304.33 g/mol. Its IUPAC name is 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene |
| PubChem CID | 139832437 |
| Molecular Formula | C14H15F3O2S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene |
| SMILES | CC1(C)Oc2ccc(SC(F)(F)F)cc2CC1C1CO1 |
| InChI | InChI=1S/C14H15F3O2S/c1-13(2)10(12-7-18-12)6-8-5-9(20-14(15,16)17)3-4-11(8)19-13/h3-5,10,12H,6-7H2,1-2H3 |
| InChIKey | HJVDOWKBRWZNIV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene?
The IUPAC name of 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene (CID 139832437) is 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene.
What is the SMILES notation for 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene?
The canonical SMILES for 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene is CC1(C)Oc2ccc(SC(F)(F)F)cc2CC1C1CO1.
What is the InChIKey of 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene?
The InChIKey is HJVDOWKBRWZNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3O2S/c1-13(2)10(12-7-18-12)6-8-5-9(20-14(15,16)17)3-4-11(8)19-13/h3-5,10,12H,6-7H2,1-2H3.
What are the key properties of 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene?
2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene has a molecular weight of 304.33 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(oxiran-2-yl)-6-(trifluoromethylsulfanyl)-3,4-dihydrochromene is sourced from PubChem (CID 139832437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).