About 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene
2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene (PubChem CID 139832442) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene.
Molecular Properties
| Compound Name | 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene |
| PubChem CID | 139832442 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene |
| SMILES | CC1(C)CCC=CC1C#Cc1ccccc1 |
| InChI | InChI=1S/C16H18/c1-16(2)13-7-6-10-15(16)12-11-14-8-4-3-5-9-14/h3-6,8-10,15H,7,13H2,1-2H3 |
| InChIKey | ULIMZFZXZWNMNM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene?
The IUPAC name of 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene (CID 139832442) is 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene.
What is the SMILES notation for 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene?
The canonical SMILES for 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene is CC1(C)CCC=CC1C#Cc1ccccc1.
What is the InChIKey of 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene?
The InChIKey is ULIMZFZXZWNMNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18/c1-16(2)13-7-6-10-15(16)12-11-14-8-4-3-5-9-14/h3-6,8-10,15H,7,13H2,1-2H3.
What are the key properties of 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene?
2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene has a molecular weight of 210.32 g/mol, XLogP of 4.03, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-dimethylcyclohex-2-en-1-yl)ethynylbenzene is sourced from PubChem (CID 139832442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).