C15H16N2O4S — CID 139833837
N-(3,5-dimethoxyphenyl)-2-(furan-2-ylmethylamino)-2-sulfanylideneacetamide (PubChem CID 139833837) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-(furan-2-ylmethylamino)-2-sulfanylideneacetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-(furan-2-ylmethylamino)-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 139833837 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-(furan-2-ylmethylamino)-2-sulfanylideneacetamide |
| SMILES | COc1cc(NC(=O)C(=S)NCc2ccco2)cc(OC)c1 |
| InChI | InChI=1S/C15H16N2O4S/c1-19-12-6-10(7-13(8-12)20-2)17-14(18)15(22)16-9-11-4-3-5-21-11/h3-8H,9H2,1-2H3,(H,16,22)(H,17,18) |
| InChIKey | YWVMELVJNIOUFV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|