About (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide
(2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide (PubChem CID 139834314) has the molecular formula C12H26N2O3
and a molecular weight of 246.35 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide.
Molecular Properties
| Compound Name | (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide |
| PubChem CID | 139834314 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide |
| SMILES | CC[C@H](N[C@@H](CC(C)C)C(N)=O)C(OC)OC |
| InChI | InChI=1S/C12H26N2O3/c1-6-9(12(16-4)17-5)14-10(11(13)15)7-8(2)3/h8-10,12,14H,6-7H2,1-5H3,(H2,13,15)/t9-,10-/m0/s1 |
| InChIKey | LVEIQHDQAZYTTA-UWVGGRQHSA-N |
| XLogP | 0.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide?
The IUPAC name of (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide (CID 139834314) is (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide.
What is the SMILES notation for (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide?
The canonical SMILES for (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide is CC[C@H](N[C@@H](CC(C)C)C(N)=O)C(OC)OC.
What is the InChIKey of (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide?
The InChIKey is LVEIQHDQAZYTTA-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H26N2O3/c1-6-9(12(16-4)17-5)14-10(11(13)15)7-8(2)3/h8-10,12,14H,6-7H2,1-5H3,(H2,13,15)/t9-,10-/m0/s1.
What are the key properties of (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide?
(2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide has a molecular weight of 246.35 g/mol, XLogP of 0.87, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(2S)-1,1-dimethoxybutan-2-yl]amino]-4-methylpentanamide is sourced from PubChem (CID 139834314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).