About 3,3-dimethyloxiran-2-imine
3,3-dimethyloxiran-2-imine (PubChem CID 139834358) has the molecular formula C4H7NO
and a molecular weight of 85.11 g/mol. Its IUPAC name is 3,3-dimethyloxiran-2-imine.
Molecular Properties
| Compound Name | 3,3-dimethyloxiran-2-imine |
| PubChem CID | 139834358 |
| Molecular Formula | C4H7NO |
| Molecular Weight | 85.11 g/mol |
| Exact Mass | 85.05 |
| IUPAC Name | 3,3-dimethyloxiran-2-imine |
| SMILES | [H]/N=C1\OC1(C)C |
| InChI | InChI=1S/C4H7NO/c1-4(2)3(5)6-4/h5H,1-2H3/b5-3- |
| InChIKey | YGGTYJBLSYJIRF-HYXAFXHYSA-N |
| XLogP | 0.77 |
| TPSA | 36.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.11 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyloxiran-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyloxiran-2-imine?
The IUPAC name of 3,3-dimethyloxiran-2-imine (CID 139834358) is 3,3-dimethyloxiran-2-imine.
What is the SMILES notation for 3,3-dimethyloxiran-2-imine?
The canonical SMILES for 3,3-dimethyloxiran-2-imine is [H]/N=C1\OC1(C)C.
What is the InChIKey of 3,3-dimethyloxiran-2-imine?
The InChIKey is YGGTYJBLSYJIRF-HYXAFXHYSA-N. The full InChI is InChI=1S/C4H7NO/c1-4(2)3(5)6-4/h5H,1-2H3/b5-3-.
What are the key properties of 3,3-dimethyloxiran-2-imine?
3,3-dimethyloxiran-2-imine has a molecular weight of 85.11 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyloxiran-2-imine is sourced from PubChem (CID 139834358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).