About cyclohexyl(triphenyl)boranuide;tetraethylazanium
cyclohexyl(triphenyl)boranuide;tetraethylazanium (PubChem CID 139835066) has the molecular formula C32H46BN
and a molecular weight of 455.54 g/mol. Its IUPAC name is cyclohexyl(triphenyl)boranuide;tetraethylazanium.
Molecular Properties
| Compound Name | cyclohexyl(triphenyl)boranuide;tetraethylazanium |
| PubChem CID | 139835066 |
| Molecular Formula | C32H46BN |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.37 |
| IUPAC Name | cyclohexyl(triphenyl)boranuide;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.c1ccc([B-](c2ccccc2)(c2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H26B.C8H20N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5-9(6-2,7-3)8-4/h1-3,5-10,13-18,24H,4,11-12,19-20H2;5-8H2,1-4H3/q-1;+1 |
| InChIKey | NGOPNRJNBJKWCO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl(triphenyl)boranuide;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(triphenyl)boranuide;tetraethylazanium?
The IUPAC name of cyclohexyl(triphenyl)boranuide;tetraethylazanium (CID 139835066) is cyclohexyl(triphenyl)boranuide;tetraethylazanium.
What is the SMILES notation for cyclohexyl(triphenyl)boranuide;tetraethylazanium?
The canonical SMILES for cyclohexyl(triphenyl)boranuide;tetraethylazanium is CC[N+](CC)(CC)CC.c1ccc([B-](c2ccccc2)(c2ccccc2)C2CCCCC2)cc1.
What is the InChIKey of cyclohexyl(triphenyl)boranuide;tetraethylazanium?
The InChIKey is NGOPNRJNBJKWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26B.C8H20N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5-9(6-2,7-3)8-4/h1-3,5-10,13-18,24H,4,11-12,19-20H2;5-8H2,1-4H3/q-1;+1.
What are the key properties of cyclohexyl(triphenyl)boranuide;tetraethylazanium?
cyclohexyl(triphenyl)boranuide;tetraethylazanium has a molecular weight of 455.54 g/mol, XLogP of 6.37, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(triphenyl)boranuide;tetraethylazanium is sourced from PubChem (CID 139835066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).