C22H21N3O7S — CID 139835305
3'-[[4-[1-(3-methoxyphenyl)pent-1-yn-3-yloxy]-1,2,5-thiadiazol-3-yl]oxy]spiro[1,3-dioxolane-2,2'-1-azabicyclo[2.2.1]heptane]-4,5-dione (PubChem CID 139835305) has the molecular formula C22H21N3O7S and a molecular weight of 471.49 g/mol. Its IUPAC name is 3'-[[4-[1-(3-methoxyphenyl)pent-1-yn-3-yloxy]-1,2,5-thiadiazol-3-yl]oxy]spiro[1,3-dioxolane-2,2'-1-azabicyclo[2.2.1]heptane]-4,5-dione.
| Compound Name | 3'-[[4-[1-(3-methoxyphenyl)pent-1-yn-3-yloxy]-1,2,5-thiadiazol-3-yl]oxy]spiro[1,3-dioxolane-2,2'-1-azabicyclo[2.2.1]heptane]-4,5-dione |
|---|---|
| PubChem CID | 139835305 |
| Molecular Formula | C22H21N3O7S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 3'-[[4-[1-(3-methoxyphenyl)pent-1-yn-3-yloxy]-1,2,5-thiadiazol-3-yl]oxy]spiro[1,3-dioxolane-2,2'-1-azabicyclo[2.2.1]heptane]-4,5-dione |
| SMILES | CCC(C#Cc1cccc(OC)c1)Oc1nsnc1OC1C2CCN(C2)C12OC(=O)C(=O)O2 |
| InChI | InChI=1S/C22H21N3O7S/c1-3-15(8-7-13-5-4-6-16(11-13)28-2)29-18-19(24-33-23-18)30-17-14-9-10-25(12-14)22(17)31-20(26)21(27)32-22/h4-6,11,14-15,17H,3,9-10,12H2,1-2H3 |
| InChIKey | JFXYUJLKKAINCR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|