About cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium)
cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium) (PubChem CID 139836069) has the molecular formula C22H33BN2O3
and a molecular weight of 384.33 g/mol. Its IUPAC name is cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium).
Molecular Properties
| Compound Name | cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium) |
| PubChem CID | 139836069 |
| Molecular Formula | C22H33BN2O3 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium) |
| SMILES | C[NH+](C)c1ccccc1.C[NH+](C)c1ccccc1.[O-]B([O-])OC1C=CCCC1 |
| InChI | InChI=1S/2C8H11N.C6H9BO3/c2*1-9(2)8-6-4-3-5-7-8;8-7(9)10-6-4-2-1-3-5-6/h2*3-7H,1-2H3;2,4,6H,1,3,5H2/q;;-2/p+2 |
| InChIKey | YKGLJNICLLCIHV-UHFFFAOYSA-P |
| XLogP | -0.26 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium)?
The IUPAC name of cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium) (CID 139836069) is cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium).
What is the SMILES notation for cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium)?
The canonical SMILES for cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium) is C[NH+](C)c1ccccc1.C[NH+](C)c1ccccc1.[O-]B([O-])OC1C=CCCC1.
What is the InChIKey of cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium)?
The InChIKey is YKGLJNICLLCIHV-UHFFFAOYSA-P. The full InChI is InChI=1S/2C8H11N.C6H9BO3/c2*1-9(2)8-6-4-3-5-7-8;8-7(9)10-6-4-2-1-3-5-6/h2*3-7H,1-2H3;2,4,6H,1,3,5H2/q;;-2/p+2.
What are the key properties of cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium)?
cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium) has a molecular weight of 384.33 g/mol, XLogP of -0.26, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-2-en-1-yloxy(dioxido)borane;bis(dimethyl(phenyl)azanium) is sourced from PubChem (CID 139836069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).