C27H36FN3O2 — CID 139836089
2-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(2-fluoro-5-hydroxyphenyl)methyl]-N,N-diethylbenzamide (PubChem CID 139836089) has the molecular formula C27H36FN3O2 and a molecular weight of 453.60 g/mol. Its IUPAC name is 2-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(2-fluoro-5-hydroxyphenyl)methyl]-N,N-diethylbenzamide.
| Compound Name | 2-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(2-fluoro-5-hydroxyphenyl)methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 139836089 |
| Molecular Formula | C27H36FN3O2 |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 2-[[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(2-fluoro-5-hydroxyphenyl)methyl]-N,N-diethylbenzamide |
| SMILES | C=CCN1C[C@H](C)N(C(c2cc(O)ccc2F)c2ccccc2C(=O)N(CC)CC)C[C@H]1C |
| InChI | InChI=1S/C27H36FN3O2/c1-6-15-30-17-20(5)31(18-19(30)4)26(24-16-21(32)13-14-25(24)28)22-11-9-10-12-23(22)27(33)29(7-2)8-3/h6,9-14,16,19-20,26,32H,1,7-8,15,17-18H2,2-5H3/t19-,20+,26?/m1/s1 |
| InChIKey | SAZAHLCBJNKZIS-YJIDZIMYSA-N |
| XLogP | 4.68 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|