About 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole
3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole (PubChem CID 139837831) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 139837831 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole |
| SMILES | CC#CC1CC(C)=NO1 |
| InChI | InChI=1S/C7H9NO/c1-3-4-7-5-6(2)8-9-7/h7H,5H2,1-2H3 |
| InChIKey | DAPWMMZEEHAVRA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole (CID 139837831) is 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole is CC#CC1CC(C)=NO1.
What is the InChIKey of 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole?
The InChIKey is DAPWMMZEEHAVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-3-4-7-5-6(2)8-9-7/h7H,5H2,1-2H3.
What are the key properties of 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole?
3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole has a molecular weight of 123.15 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-prop-1-ynyl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 139837831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).