C44H35BrN2O2S — CID 139837870
5-[[3-[[[(1S)-1-(4-bromophenyl)ethyl]amino]-phenylmethyl]phenyl]methylidene]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 139837870) has the molecular formula C44H35BrN2O2S and a molecular weight of 735.75 g/mol. Its IUPAC name is 5-[[3-[[[(1S)-1-(4-bromophenyl)ethyl]amino]-phenylmethyl]phenyl]methylidene]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[[[(1S)-1-(4-bromophenyl)ethyl]amino]-phenylmethyl]phenyl]methylidene]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139837870 |
| Molecular Formula | C44H35BrN2O2S |
| Molecular Weight | 735.75 g/mol |
| Exact Mass | 734.16 |
| IUPAC Name | 5-[[3-[[[(1S)-1-(4-bromophenyl)ethyl]amino]-phenylmethyl]phenyl]methylidene]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@H](NC(c1ccccc1)c1cccc(C=C2SC(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C44H35BrN2O2S/c1-31(33-25-27-39(45)28-26-33)46-41(34-16-6-2-7-17-34)35-18-14-15-32(29-35)30-40-42(48)47(43(49)50-40)44(36-19-8-3-9-20-36,37-21-10-4-11-22-37)38-23-12-5-13-24-38/h2-31,41,46H,1H3/t31-,41?/m0/s1 |
| InChIKey | DJARGZOYJCITRV-HCRWCUGGSA-N |
| XLogP | 10.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.75 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|