C14H18O4 — CID 139838112
5-(2-cyclopenta-2,4-dien-1-ylpropyl)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 139838112) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 5-(2-cyclopenta-2,4-dien-1-ylpropyl)-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(2-cyclopenta-2,4-dien-1-ylpropyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 139838112 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 5-(2-cyclopenta-2,4-dien-1-ylpropyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(CC1C(=O)OC(C)(C)OC1=O)C1C=CC=C1 |
| InChI | InChI=1S/C14H18O4/c1-9(10-6-4-5-7-10)8-11-12(15)17-14(2,3)18-13(11)16/h4-7,9-11H,8H2,1-3H3 |
| InChIKey | YYJVSBLRPKLADO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|