About 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one
5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one (PubChem CID 139838418) has the molecular formula C28H48O3Si2
and a molecular weight of 488.86 g/mol. Its IUPAC name is 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one.
Molecular Properties
| Compound Name | 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one |
| PubChem CID | 139838418 |
| Molecular Formula | C28H48O3Si2 |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one |
| SMILES | CC1=CC=C2C(CCCC(C)C(CCCCC(C)O[Si](C)(C)C)O[Si](C)(C)C)=CC=C2C1=O |
| InChI | InChI=1S/C28H48O3Si2/c1-21(13-12-15-24-18-20-26-25(24)19-17-22(2)28(26)29)27(31-33(7,8)9)16-11-10-14-23(3)30-32(4,5)6/h17-21,23,27H,10-16H2,1-9H3 |
| InChIKey | XBOUZGLKIGSPHE-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one?
The IUPAC name of 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one (CID 139838418) is 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one.
What is the SMILES notation for 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one?
The canonical SMILES for 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one is CC1=CC=C2C(CCCC(C)C(CCCCC(C)O[Si](C)(C)C)O[Si](C)(C)C)=CC=C2C1=O.
What is the InChIKey of 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one?
The InChIKey is XBOUZGLKIGSPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H48O3Si2/c1-21(13-12-15-24-18-20-26-25(24)19-17-22(2)28(26)29)27(31-33(7,8)9)16-11-10-14-23(3)30-32(4,5)6/h17-21,23,27H,10-16H2,1-9H3.
What are the key properties of 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one?
5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one has a molecular weight of 488.86 g/mol, XLogP of 8.14, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-[4-methyl-5,10-bis(trimethylsilyloxy)undecyl]inden-4-one is sourced from PubChem (CID 139838418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).