About 3-propoxyhexan-1-ol
3-propoxyhexan-1-ol (PubChem CID 139839964) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-propoxyhexan-1-ol.
Molecular Properties
| Compound Name | 3-propoxyhexan-1-ol |
| PubChem CID | 139839964 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 3-propoxyhexan-1-ol |
| SMILES | CCCOC(CCC)CCO |
| InChI | InChI=1S/C9H20O2/c1-3-5-9(6-7-10)11-8-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | WHEAGAIIIKMADC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propoxyhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxyhexan-1-ol?
The IUPAC name of 3-propoxyhexan-1-ol (CID 139839964) is 3-propoxyhexan-1-ol.
What is the SMILES notation for 3-propoxyhexan-1-ol?
The canonical SMILES for 3-propoxyhexan-1-ol is CCCOC(CCC)CCO.
What is the InChIKey of 3-propoxyhexan-1-ol?
The InChIKey is WHEAGAIIIKMADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2/c1-3-5-9(6-7-10)11-8-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 3-propoxyhexan-1-ol?
3-propoxyhexan-1-ol has a molecular weight of 160.26 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxyhexan-1-ol is sourced from PubChem (CID 139839964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).