About 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol
4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol (PubChem CID 139840536) has the molecular formula C13H20O3S
and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol.
Molecular Properties
| Compound Name | 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol |
| PubChem CID | 139840536 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol |
| SMILES | Cc1cc(OCCSCCO)c(C)c(C)c1O |
| InChI | InChI=1S/C13H20O3S/c1-9-8-12(10(2)11(3)13(9)15)16-5-7-17-6-4-14/h8,14-15H,4-7H2,1-3H3 |
| InChIKey | QJIGBNVGNVWNSM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol?
The IUPAC name of 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol (CID 139840536) is 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol.
What is the SMILES notation for 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol?
The canonical SMILES for 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol is Cc1cc(OCCSCCO)c(C)c(C)c1O.
What is the InChIKey of 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol?
The InChIKey is QJIGBNVGNVWNSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3S/c1-9-8-12(10(2)11(3)13(9)15)16-5-7-17-6-4-14/h8,14-15H,4-7H2,1-3H3.
What are the key properties of 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol?
4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol has a molecular weight of 256.37 g/mol, XLogP of 2.42, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3,6-trimethylphenol is sourced from PubChem (CID 139840536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).