C16H19N3O2S — CID 139840553
1-hydroxy-1-[[2-(pyridin-3-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophen-5-yl]methyl]urea (PubChem CID 139840553) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-hydroxy-1-[[2-(pyridin-3-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophen-5-yl]methyl]urea.
| Compound Name | 1-hydroxy-1-[[2-(pyridin-3-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophen-5-yl]methyl]urea |
|---|---|
| PubChem CID | 139840553 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-hydroxy-1-[[2-(pyridin-3-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophen-5-yl]methyl]urea |
| SMILES | NC(=O)N(O)CC1CCc2sc(Cc3cccnc3)cc2C1 |
| InChI | InChI=1S/C16H19N3O2S/c17-16(20)19(21)10-12-3-4-15-13(6-12)8-14(22-15)7-11-2-1-5-18-9-11/h1-2,5,8-9,12,21H,3-4,6-7,10H2,(H2,17,20) |
| InChIKey | KLUJYTWICFFERK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|