About 5-nitropent-2-yne
5-nitropent-2-yne (PubChem CID 139841428) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is 5-nitropent-2-yne.
Molecular Properties
| Compound Name | 5-nitropent-2-yne |
| PubChem CID | 139841428 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 5-nitropent-2-yne |
| SMILES | CC#CCC[N+](=O)[O-] |
| InChI | InChI=1S/C5H7NO2/c1-2-3-4-5-6(7)8/h4-5H2,1H3 |
| InChIKey | LFVTXSBXKBTPRQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitropent-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitropent-2-yne?
The IUPAC name of 5-nitropent-2-yne (CID 139841428) is 5-nitropent-2-yne.
What is the SMILES notation for 5-nitropent-2-yne?
The canonical SMILES for 5-nitropent-2-yne is CC#CCC[N+](=O)[O-].
What is the InChIKey of 5-nitropent-2-yne?
The InChIKey is LFVTXSBXKBTPRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2/c1-2-3-4-5-6(7)8/h4-5H2,1H3.
What are the key properties of 5-nitropent-2-yne?
5-nitropent-2-yne has a molecular weight of 113.12 g/mol, XLogP of 0.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitropent-2-yne is sourced from PubChem (CID 139841428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).