C14H17NO3S — CID 139841467
[(E)-[(3Z)-3-phenylhepta-3,6-dien-2-ylidene]amino] methanesulfonate (PubChem CID 139841467) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is [(E)-[(3Z)-3-phenylhepta-3,6-dien-2-ylidene]amino] methanesulfonate.
| Compound Name | [(E)-[(3Z)-3-phenylhepta-3,6-dien-2-ylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 139841467 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [(E)-[(3Z)-3-phenylhepta-3,6-dien-2-ylidene]amino] methanesulfonate |
| SMILES | C=CC/C=C(C(\C)=N\OS(C)(=O)=O)/c1ccccc1 |
| InChI | InChI=1S/C14H17NO3S/c1-4-5-11-14(13-9-7-6-8-10-13)12(2)15-18-19(3,16)17/h4,6-11H,1,5H2,2-3H3/b14-11+,15-12+ |
| InChIKey | YALBPIRQTXYQJN-LCPPQYOVSA-N |
| XLogP | 3.00 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|