About [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate
[(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate (PubChem CID 139841470) has the molecular formula C13H15NO3S
and a molecular weight of 265.33 g/mol. Its IUPAC name is [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate.
Molecular Properties
| Compound Name | [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate |
| PubChem CID | 139841470 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate |
| SMILES | C=CC=C(C)C(=NOS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO3S/c1-4-8-11(2)13(14-17-18(3,15)16)12-9-6-5-7-10-12/h4-10H,1H2,2-3H3 |
| InChIKey | MNDGFBPOIRGDST-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate?
The IUPAC name of [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate (CID 139841470) is [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate.
What is the SMILES notation for [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate?
The canonical SMILES for [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate is C=CC=C(C)C(=NOS(C)(=O)=O)c1ccccc1.
What is the InChIKey of [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate?
The InChIKey is MNDGFBPOIRGDST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3S/c1-4-8-11(2)13(14-17-18(3,15)16)12-9-6-5-7-10-12/h4-10H,1H2,2-3H3.
What are the key properties of [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate?
[(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate has a molecular weight of 265.33 g/mol, XLogP of 2.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-methyl-1-phenylpenta-2,4-dienylidene)amino] methanesulfonate is sourced from PubChem (CID 139841470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).