C15H19NO3S — CID 139841477
[(E)-[(2Z,5E)-2-methyl-1-phenylhepta-2,5-dienylidene]amino] methanesulfonate (PubChem CID 139841477) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is [(E)-[(2Z,5E)-2-methyl-1-phenylhepta-2,5-dienylidene]amino] methanesulfonate.
| Compound Name | [(E)-[(2Z,5E)-2-methyl-1-phenylhepta-2,5-dienylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 139841477 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | [(E)-[(2Z,5E)-2-methyl-1-phenylhepta-2,5-dienylidene]amino] methanesulfonate |
| SMILES | C/C=C/C/C=C(C)\C(=N/OS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO3S/c1-4-5-7-10-13(2)15(16-19-20(3,17)18)14-11-8-6-9-12-14/h4-6,8-12H,7H2,1-3H3/b5-4+,13-10-,16-15+ |
| InChIKey | YXHWIMAVHFNITF-ZMNPNQDWSA-N |
| XLogP | 3.28 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|