C25H29N3O3S — CID 1398416
5-[[4-(azepan-1-yl)phenyl]methylidene]-1-(4-ethoxycyclohexa-1,3-dien-1-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 1398416) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is 5-[[4-(azepan-1-yl)phenyl]methylidene]-1-(4-ethoxycyclohexa-1,3-dien-1-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-(azepan-1-yl)phenyl]methylidene]-1-(4-ethoxycyclohexa-1,3-dien-1-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 1398416 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 5-[[4-(azepan-1-yl)phenyl]methylidene]-1-(4-ethoxycyclohexa-1,3-dien-1-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCOC1=CC=C(N2C(=O)C(=Cc3ccc(N4CCCCCC4)cc3)C(=O)NC2=S)CC1 |
| InChI | InChI=1S/C25H29N3O3S/c1-2-31-21-13-11-20(12-14-21)28-24(30)22(23(29)26-25(28)32)17-18-7-9-19(10-8-18)27-15-5-3-4-6-16-27/h7-11,13,17H,2-6,12,14-16H2,1H3,(H,26,29,32) |
| InChIKey | VJBSAJZQEJOPLX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|