C21H21N3O5S — CID 139842056
N-ethynyl-3,4-dimethoxy-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]benzenesulfonamide (PubChem CID 139842056) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is N-ethynyl-3,4-dimethoxy-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | N-ethynyl-3,4-dimethoxy-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139842056 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-ethynyl-3,4-dimethoxy-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]benzenesulfonamide |
| SMILES | C#CN(c1ccc(C2=NNC(=O)CC2C)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H21N3O5S/c1-5-24(30(26,27)17-10-11-18(28-3)19(13-17)29-4)16-8-6-15(7-9-16)21-14(2)12-20(25)22-23-21/h1,6-11,13-14H,12H2,2-4H3,(H,22,25) |
| InChIKey | UQOGYDMAOFPOPL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|