C27H36N2O4 — CID 139842483
[(2S,3S,5R)-3-hydroxy-7-methyl-5-(methylcarbamoyl)-1-phenyloctan-2-yl] 5,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 139842483) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is [(2S,3S,5R)-3-hydroxy-7-methyl-5-(methylcarbamoyl)-1-phenyloctan-2-yl] 5,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | [(2S,3S,5R)-3-hydroxy-7-methyl-5-(methylcarbamoyl)-1-phenyloctan-2-yl] 5,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 139842483 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | [(2S,3S,5R)-3-hydroxy-7-methyl-5-(methylcarbamoyl)-1-phenyloctan-2-yl] 5,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CNC(=O)[C@H](CC(C)C)C[C@H](O)[C@H](Cc1ccccc1)OC(=O)c1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C27H36N2O4/c1-18(2)13-21(26(31)28-3)16-24(30)25(14-19-9-5-4-6-10-19)33-27(32)22-15-20-11-7-8-12-23(20)29-17-22/h4-6,9-10,15,17-18,21,24-25,30H,7-8,11-14,16H2,1-3H3,(H,28,31)/t21-,24+,25+/m1/s1 |
| InChIKey | WCGMBWDKYGRAQD-ZODMCCGTSA-N |
| XLogP | 3.89 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |