C18H19Cl2NO4 — CID 139843053
ethyl (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoate (PubChem CID 139843053) has the molecular formula C18H19Cl2NO4 and a molecular weight of 384.26 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoate |
|---|---|
| PubChem CID | 139843053 |
| Molecular Formula | C18H19Cl2NO4 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | ethyl (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-(2-methoxyethoxy)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C/C=C/c1cc2cc(Cl)c(Cl)cc2[nH]1)OCCOC |
| InChI | InChI=1S/C18H19Cl2NO4/c1-3-24-18(22)17(25-8-7-23-2)6-4-5-13-9-12-10-14(19)15(20)11-16(12)21-13/h4-6,9-11,21H,3,7-8H2,1-2H3/b5-4+,17-6- |
| InChIKey | RKLUGGACWLPTAO-INCRNZDESA-N |
| XLogP | 4.60 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|