About 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one
2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one (PubChem CID 139843153) has the molecular formula C9H11N5O2
and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one |
| PubChem CID | 139843153 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(NC2CCCO2)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H11N5O2/c15-8-6-7(11-4-10-6)13-9(14-8)12-5-2-1-3-16-5/h4-5H,1-3H2,(H3,10,11,12,13,14,15) |
| InChIKey | LWRPXOQEUXIQFN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one?
The IUPAC name of 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one (CID 139843153) is 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one?
The canonical SMILES for 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one is O=c1[nH]c(NC2CCCO2)nc2nc[nH]c12.
What is the InChIKey of 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one?
The InChIKey is LWRPXOQEUXIQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O2/c15-8-6-7(11-4-10-6)13-9(14-8)12-5-2-1-3-16-5/h4-5H,1-3H2,(H3,10,11,12,13,14,15).
What are the key properties of 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one?
2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one has a molecular weight of 221.22 g/mol, XLogP of 0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-ylamino)-1,7-dihydropurin-6-one is sourced from PubChem (CID 139843153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).