About 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride
2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride (PubChem CID 139844009) has the molecular formula C4H13Cl2N3O
and a molecular weight of 190.07 g/mol. Its IUPAC name is 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride |
| PubChem CID | 139844009 |
| Molecular Formula | C4H13Cl2N3O |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)C(CN)CO |
| InChI | InChI=1S/C4H11N3O.2ClH/c5-1-3(2-8)4(6)7;;/h3,8H,1-2,5H2,(H3,6,7);2*1H |
| InChIKey | HJSMCBIICFDWOH-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 96.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride?
The IUPAC name of 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride (CID 139844009) is 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride.
What is the SMILES notation for 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride?
The canonical SMILES for 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride is Cl.Cl.[H]/N=C(\N)C(CN)CO.
What is the InChIKey of 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride?
The InChIKey is HJSMCBIICFDWOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O.2ClH/c5-1-3(2-8)4(6)7;;/h3,8H,1-2,5H2,(H3,6,7);2*1H.
What are the key properties of 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride?
2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride has a molecular weight of 190.07 g/mol, XLogP of -0.67, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-hydroxypropanimidamide;dihydrochloride is sourced from PubChem (CID 139844009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).