About (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate
(1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate (PubChem CID 139844662) has the molecular formula C12H12F2O2
and a molecular weight of 226.22 g/mol. Its IUPAC name is (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate.
Molecular Properties
| Compound Name | (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate |
| PubChem CID | 139844662 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate |
| SMILES | CC(=O)OC1CCc2ccccc2C1(F)F |
| InChI | InChI=1S/C12H12F2O2/c1-8(15)16-11-7-6-9-4-2-3-5-10(9)12(11,13)14/h2-5,11H,6-7H2,1H3 |
| InChIKey | VCTWDZVXCFRARF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate?
The IUPAC name of (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate (CID 139844662) is (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate.
What is the SMILES notation for (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate?
The canonical SMILES for (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate is CC(=O)OC1CCc2ccccc2C1(F)F.
What is the InChIKey of (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate?
The InChIKey is VCTWDZVXCFRARF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O2/c1-8(15)16-11-7-6-9-4-2-3-5-10(9)12(11,13)14/h2-5,11H,6-7H2,1H3.
What are the key properties of (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate?
(1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate has a molecular weight of 226.22 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-difluoro-3,4-dihydro-2H-naphthalen-2-yl) acetate is sourced from PubChem (CID 139844662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).